C22H24ClF3N6O — CID 122687111
N'-(3-chloro-4-fluorophenyl)-2-[[1-(dimethylamino)cyclopentyl]methylamino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide (PubChem CID 122687111) has the molecular formula C22H24ClF3N6O and a molecular weight of 480.92 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-2-[[1-(dimethylamino)cyclopentyl]methylamino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-2-[[1-(dimethylamino)cyclopentyl]methylamino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122687111 |
| Molecular Formula | C22H24ClF3N6O |
| Molecular Weight | 480.92 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-2-[[1-(dimethylamino)cyclopentyl]methylamino]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
| SMILES | CN(C)C1(CNc2nc3c(F)c(F)cc(/C(=N/c4ccc(F)c(Cl)c4)NO)c3[nH]2)CCCC1 |
| InChI | InChI=1S/C22H24ClF3N6O/c1-32(2)22(7-3-4-8-22)11-27-21-29-18-13(10-16(25)17(26)19(18)30-21)20(31-33)28-12-5-6-15(24)14(23)9-12/h5-6,9-10,33H,3-4,7-8,11H2,1-2H3,(H,28,31)(H2,27,29,30) |
| InChIKey | SGHXREJLOMGDLV-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 88.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.92 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|