C19H17ClF3N5O — CID 122686765
N'-(3-chloro-4-fluorophenyl)-2-[(cyclopropylmethylamino)methyl]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide (PubChem CID 122686765) has the molecular formula C19H17ClF3N5O and a molecular weight of 423.83 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-2-[(cyclopropylmethylamino)methyl]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-2-[(cyclopropylmethylamino)methyl]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122686765 |
| Molecular Formula | C19H17ClF3N5O |
| Molecular Weight | 423.83 g/mol |
| Exact Mass | 423.11 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-2-[(cyclopropylmethylamino)methyl]-6,7-difluoro-N-hydroxy-3H-benzimidazole-4-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Cl)c1)c1cc(F)c(F)c2nc(CNCC3CC3)[nH]c12 |
| InChI | InChI=1S/C19H17ClF3N5O/c20-12-5-10(3-4-13(12)21)25-19(28-29)11-6-14(22)16(23)18-17(11)26-15(27-18)8-24-7-9-1-2-9/h3-6,9,24,29H,1-2,7-8H2,(H,25,28)(H,26,27) |
| InChIKey | RVGMWBGHUFZVOB-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.83 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|