C21H21ClF3N5O3 — CID 139503026
tert-butyl-[2-[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]ethyl]carbamic acid (PubChem CID 139503026) has the molecular formula C21H21ClF3N5O3 and a molecular weight of 483.88 g/mol. Its IUPAC name is tert-butyl-[2-[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]ethyl]carbamic acid.
| Compound Name | tert-butyl-[2-[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]ethyl]carbamic acid |
|---|---|
| PubChem CID | 139503026 |
| Molecular Formula | C21H21ClF3N5O3 |
| Molecular Weight | 483.88 g/mol |
| Exact Mass | 483.13 |
| IUPAC Name | tert-butyl-[2-[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-4,5-difluoro-1H-benzimidazol-2-yl]ethyl]carbamic acid |
| SMILES | CC(C)(C)N(CCc1nc2c(F)c(F)cc(/C(=N/c3ccc(F)c(Cl)c3)NO)c2[nH]1)C(=O)O |
| InChI | InChI=1S/C21H21ClF3N5O3/c1-21(2,3)30(20(31)32)7-6-15-27-17-11(9-14(24)16(25)18(17)28-15)19(29-33)26-10-4-5-13(23)12(22)8-10/h4-5,8-9,33H,6-7H2,1-3H3,(H,26,29)(H,27,28)(H,31,32) |
| InChIKey | FLBVEEVHLUPKBP-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 113.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.88 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|