C18H13ClF3N7O — CID 122686988
N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(1H-imidazol-2-ylmethylamino)-3H-benzimidazole-4-carboximidamide (PubChem CID 122686988) has the molecular formula C18H13ClF3N7O and a molecular weight of 435.80 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(1H-imidazol-2-ylmethylamino)-3H-benzimidazole-4-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(1H-imidazol-2-ylmethylamino)-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122686988 |
| Molecular Formula | C18H13ClF3N7O |
| Molecular Weight | 435.80 g/mol |
| Exact Mass | 435.08 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(1H-imidazol-2-ylmethylamino)-3H-benzimidazole-4-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Cl)c1)c1cc(F)c(F)c2nc(NCc3ncc[nH]3)[nH]c12 |
| InChI | InChI=1S/C18H13ClF3N7O/c19-10-5-8(1-2-11(10)20)26-17(29-30)9-6-12(21)14(22)16-15(9)27-18(28-16)25-7-13-23-3-4-24-13/h1-6,30H,7H2,(H,23,24)(H,26,29)(H2,25,27,28) |
| InChIKey | DPYLQGPCBMCBBW-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 114.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.80 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|