C22H22ClF3N6O2 — CID 122686788
N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[[(3R)-1-(oxetan-3-yl)piperidin-3-yl]amino]-3H-benzimidazole-4-carboximidamide (PubChem CID 122686788) has the molecular formula C22H22ClF3N6O2 and a molecular weight of 494.91 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[[(3R)-1-(oxetan-3-yl)piperidin-3-yl]amino]-3H-benzimidazole-4-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[[(3R)-1-(oxetan-3-yl)piperidin-3-yl]amino]-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122686788 |
| Molecular Formula | C22H22ClF3N6O2 |
| Molecular Weight | 494.91 g/mol |
| Exact Mass | 494.14 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-[[(3R)-1-(oxetan-3-yl)piperidin-3-yl]amino]-3H-benzimidazole-4-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Cl)c1)c1cc(F)c(F)c2nc(N[C@@H]3CCCN(C4COC4)C3)[nH]c12 |
| InChI | InChI=1S/C22H22ClF3N6O2/c23-15-6-11(3-4-16(15)24)27-21(31-33)14-7-17(25)18(26)20-19(14)29-22(30-20)28-12-2-1-5-32(8-12)13-9-34-10-13/h3-4,6-7,12-13,33H,1-2,5,8-10H2,(H,27,31)(H2,28,29,30)/t12-/m1/s1 |
| InChIKey | OWYKAVVUVHRQOY-GFCCVEGCSA-N |
| XLogP | 3.97 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|