C21H23ClF2N6O2 — CID 122687710
N'-(3-chlorophenyl)-6,7-difluoro-N-hydroxy-2-[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]-3H-benzimidazole-4-carboximidamide (PubChem CID 122687710) has the molecular formula C21H23ClF2N6O2 and a molecular weight of 464.90 g/mol. Its IUPAC name is N'-(3-chlorophenyl)-6,7-difluoro-N-hydroxy-2-[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]-3H-benzimidazole-4-carboximidamide.
| Compound Name | N'-(3-chlorophenyl)-6,7-difluoro-N-hydroxy-2-[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122687710 |
| Molecular Formula | C21H23ClF2N6O2 |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 464.15 |
| IUPAC Name | N'-(3-chlorophenyl)-6,7-difluoro-N-hydroxy-2-[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]-3H-benzimidazole-4-carboximidamide |
| SMILES | COCCN1CCC(Nc2nc3c(F)c(F)cc(/C(=N/c4cccc(Cl)c4)NO)c3[nH]2)C1 |
| InChI | InChI=1S/C21H23ClF2N6O2/c1-32-8-7-30-6-5-14(11-30)26-21-27-18-15(10-16(23)17(24)19(18)28-21)20(29-31)25-13-4-2-3-12(22)9-13/h2-4,9-10,14,31H,5-8,11H2,1H3,(H,25,29)(H2,26,27,28) |
| InChIKey | SDXOHZROPRVEEK-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 97.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|