C18H20ClFN6O3 — CID 137097874
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[2-(2-methoxyethoxy)ethylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 137097874) has the molecular formula C18H20ClFN6O3 and a molecular weight of 422.85 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[2-(2-methoxyethoxy)ethylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[2-(2-methoxyethoxy)ethylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 137097874 |
| Molecular Formula | C18H20ClFN6O3 |
| Molecular Weight | 422.85 g/mol |
| Exact Mass | 422.13 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[2-(2-methoxyethoxy)ethylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | COCCOCCNc1nc2nccc(/C(=N/c3ccc(F)c(Cl)c3)NO)c2[nH]1 |
| InChI | InChI=1S/C18H20ClFN6O3/c1-28-8-9-29-7-6-22-18-24-15-12(4-5-21-17(15)25-18)16(26-27)23-11-2-3-14(20)13(19)10-11/h2-5,10,27H,6-9H2,1H3,(H,23,26)(H2,21,22,24,25) |
| InChIKey | NKIBNNOBFVBQPA-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 116.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.85 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|