C17H17ClFN7O3 — CID 137146059
methyl N-[2-[[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]ethyl]carbamate (PubChem CID 137146059) has the molecular formula C17H17ClFN7O3 and a molecular weight of 421.82 g/mol. Its IUPAC name is methyl N-[2-[[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]ethyl]carbamate.
| Compound Name | methyl N-[2-[[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]ethyl]carbamate |
|---|---|
| PubChem CID | 137146059 |
| Molecular Formula | C17H17ClFN7O3 |
| Molecular Weight | 421.82 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | methyl N-[2-[[7-[N'-(3-chloro-4-fluorophenyl)-N-hydroxycarbamimidoyl]-1H-imidazo[4,5-b]pyridin-2-yl]amino]ethyl]carbamate |
| SMILES | COC(=O)NCCNc1nc2nccc(/C(=N/c3ccc(F)c(Cl)c3)NO)c2[nH]1 |
| InChI | InChI=1S/C17H17ClFN7O3/c1-29-17(27)22-7-6-21-16-24-13-10(4-5-20-15(13)25-16)14(26-28)23-9-2-3-12(19)11(18)8-9/h2-5,8,28H,6-7H2,1H3,(H,22,27)(H,23,26)(H2,20,21,24,25) |
| InChIKey | QBROTZRFTOKFSP-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 136.55 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.82 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|