C14H12ClFN6O — CID 137097616
2-(aminomethyl)-N'-(3-chloro-4-fluorophenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 137097616) has the molecular formula C14H12ClFN6O and a molecular weight of 334.74 g/mol. Its IUPAC name is 2-(aminomethyl)-N'-(3-chloro-4-fluorophenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | 2-(aminomethyl)-N'-(3-chloro-4-fluorophenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 137097616 |
| Molecular Formula | C14H12ClFN6O |
| Molecular Weight | 334.74 g/mol |
| Exact Mass | 334.07 |
| IUPAC Name | 2-(aminomethyl)-N'-(3-chloro-4-fluorophenyl)-N-hydroxy-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | NCc1nc2nccc(/C(=N/c3ccc(F)c(Cl)c3)NO)c2[nH]1 |
| InChI | InChI=1S/C14H12ClFN6O/c15-9-5-7(1-2-10(9)16)19-13(22-23)8-3-4-18-14-12(8)20-11(6-17)21-14/h1-5,23H,6,17H2,(H,19,22)(H,18,20,21) |
| InChIKey | SWNOMRMCNIQILG-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 112.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.74 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|