C18H15ClFN7OS — CID 137097881
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(1,3-thiazol-2-ylmethylamino)methyl]-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 137097881) has the molecular formula C18H15ClFN7OS and a molecular weight of 431.88 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(1,3-thiazol-2-ylmethylamino)methyl]-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(1,3-thiazol-2-ylmethylamino)methyl]-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 137097881 |
| Molecular Formula | C18H15ClFN7OS |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.07 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(1,3-thiazol-2-ylmethylamino)methyl]-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Cl)c1)c1ccnc2nc(CNCc3nccs3)[nH]c12 |
| InChI | InChI=1S/C18H15ClFN7OS/c19-12-7-10(1-2-13(12)20)24-17(27-28)11-3-4-23-18-16(11)25-14(26-18)8-21-9-15-22-5-6-29-15/h1-7,21,28H,8-9H2,(H,24,27)(H,23,25,26) |
| InChIKey | PYRVZFJGSUYMAW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 111.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|