C17H16ClFN6O2 — CID 137097897
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-(oxolan-3-ylamino)-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 137097897) has the molecular formula C17H16ClFN6O2 and a molecular weight of 390.81 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-(oxolan-3-ylamino)-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-(oxolan-3-ylamino)-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 137097897 |
| Molecular Formula | C17H16ClFN6O2 |
| Molecular Weight | 390.81 g/mol |
| Exact Mass | 390.10 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-(oxolan-3-ylamino)-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Cl)c1)c1ccnc2nc(NC3CCOC3)[nH]c12 |
| InChI | InChI=1S/C17H16ClFN6O2/c18-12-7-9(1-2-13(12)19)21-15(25-26)11-3-5-20-16-14(11)23-17(24-16)22-10-4-6-27-8-10/h1-3,5,7,10,26H,4,6,8H2,(H,21,25)(H2,20,22,23,24) |
| InChIKey | DDMPVZZKRGPFMB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.81 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|