C19H21ClFN7O2 — CID 137097559
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[[(3R)-4-methylmorpholin-3-yl]methylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 137097559) has the molecular formula C19H21ClFN7O2 and a molecular weight of 433.88 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[[(3R)-4-methylmorpholin-3-yl]methylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[[(3R)-4-methylmorpholin-3-yl]methylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 137097559 |
| Molecular Formula | C19H21ClFN7O2 |
| Molecular Weight | 433.88 g/mol |
| Exact Mass | 433.14 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[[(3R)-4-methylmorpholin-3-yl]methylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | CN1CCOC[C@H]1CNc1nc2nccc(/C(=N/c3ccc(F)c(Cl)c3)NO)c2[nH]1 |
| InChI | InChI=1S/C19H21ClFN7O2/c1-28-6-7-30-10-12(28)9-23-19-25-16-13(4-5-22-18(16)26-19)17(27-29)24-11-2-3-15(21)14(20)8-11/h2-5,8,12,29H,6-7,9-10H2,1H3,(H,24,27)(H2,22,23,25,26)/t12-/m1/s1 |
| InChIKey | KEKDDAPUHHQTFP-GFCCVEGCSA-N |
| XLogP | 2.55 |
| TPSA | 110.69 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.88 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|