C19H20ClFN6O2S — CID 145190734
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(1-oxothian-3-yl)methylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 145190734) has the molecular formula C19H20ClFN6O2S and a molecular weight of 450.93 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(1-oxothian-3-yl)methylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(1-oxothian-3-yl)methylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 145190734 |
| Molecular Formula | C19H20ClFN6O2S |
| Molecular Weight | 450.93 g/mol |
| Exact Mass | 450.10 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(1-oxothian-3-yl)methylamino]-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | O=S1CCCC(CNc2nc3nccc(/C(=N/c4ccc(F)c(Cl)c4)NO)c3[nH]2)C1 |
| InChI | InChI=1S/C19H20ClFN6O2S/c20-14-8-12(3-4-15(14)21)24-17(27-28)13-5-6-22-18-16(13)25-19(26-18)23-9-11-2-1-7-30(29)10-11/h3-6,8,11,28H,1-2,7,9-10H2,(H,24,27)(H2,22,23,25,26) |
| InChIKey | AWOOEEOGRRNDDR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 115.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.93 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|