C19H18ClF3N6O — CID 122687035
N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(piperidin-3-ylamino)-3H-benzimidazole-4-carboximidamide (PubChem CID 122687035) has the molecular formula C19H18ClF3N6O and a molecular weight of 438.84 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(piperidin-3-ylamino)-3H-benzimidazole-4-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(piperidin-3-ylamino)-3H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122687035 |
| Molecular Formula | C19H18ClF3N6O |
| Molecular Weight | 438.84 g/mol |
| Exact Mass | 438.12 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-6,7-difluoro-N-hydroxy-2-(piperidin-3-ylamino)-3H-benzimidazole-4-carboximidamide |
| SMILES | ON/C(=N\c1ccc(F)c(Cl)c1)c1cc(F)c(F)c2nc(NC3CCCNC3)[nH]c12 |
| InChI | InChI=1S/C19H18ClF3N6O/c20-12-6-9(3-4-13(12)21)25-18(29-30)11-7-14(22)15(23)17-16(11)27-19(28-17)26-10-2-1-5-24-8-10/h3-4,6-7,10,24,30H,1-2,5,8H2,(H,25,29)(H2,26,27,28) |
| InChIKey | ODLNATSDXLVVLQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|