C18H20ClFN6O2 — CID 137097632
N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(3-methoxypropylamino)methyl]-1H-imidazo[4,5-b]pyridine-7-carboximidamide (PubChem CID 137097632) has the molecular formula C18H20ClFN6O2 and a molecular weight of 406.85 g/mol. Its IUPAC name is N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(3-methoxypropylamino)methyl]-1H-imidazo[4,5-b]pyridine-7-carboximidamide.
| Compound Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(3-methoxypropylamino)methyl]-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
|---|---|
| PubChem CID | 137097632 |
| Molecular Formula | C18H20ClFN6O2 |
| Molecular Weight | 406.85 g/mol |
| Exact Mass | 406.13 |
| IUPAC Name | N'-(3-chloro-4-fluorophenyl)-N-hydroxy-2-[(3-methoxypropylamino)methyl]-1H-imidazo[4,5-b]pyridine-7-carboximidamide |
| SMILES | COCCCNCc1nc2nccc(/C(=N/c3ccc(F)c(Cl)c3)NO)c2[nH]1 |
| InChI | InChI=1S/C18H20ClFN6O2/c1-28-8-2-6-21-10-15-24-16-12(5-7-22-18(16)25-15)17(26-27)23-11-3-4-14(20)13(19)9-11/h3-5,7,9,21,27H,2,6,8,10H2,1H3,(H,23,26)(H,22,24,25) |
| InChIKey | FBGBXUMIMPEBJJ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 107.45 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.85 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|