C20H23ClF3N5O2 — CID 139514070
(E,2Z)-N'-(3-chloro-4-fluorophenyl)-4,5-difluoro-N-hydroxy-2-[2-[(3-methoxypropylamino)methyl]-5-methylidene-1H-imidazol-4-ylidene]pent-3-enimidamide (PubChem CID 139514070) has the molecular formula C20H23ClF3N5O2 and a molecular weight of 457.88 g/mol. Its IUPAC name is (E,2Z)-N'-(3-chloro-4-fluorophenyl)-4,5-difluoro-N-hydroxy-2-[2-[(3-methoxypropylamino)methyl]-5-methylidene-1H-imidazol-4-ylidene]pent-3-enimidamide.
| Compound Name | (E,2Z)-N'-(3-chloro-4-fluorophenyl)-4,5-difluoro-N-hydroxy-2-[2-[(3-methoxypropylamino)methyl]-5-methylidene-1H-imidazol-4-ylidene]pent-3-enimidamide |
|---|---|
| PubChem CID | 139514070 |
| Molecular Formula | C20H23ClF3N5O2 |
| Molecular Weight | 457.88 g/mol |
| Exact Mass | 457.15 |
| IUPAC Name | (E,2Z)-N'-(3-chloro-4-fluorophenyl)-4,5-difluoro-N-hydroxy-2-[2-[(3-methoxypropylamino)methyl]-5-methylidene-1H-imidazol-4-ylidene]pent-3-enimidamide |
| SMILES | C=c1[nH]c(CNCCCOC)n/c1=C(/C=C(/F)CF)C(=N\c1ccc(F)c(Cl)c1)\NO |
| InChI | InChI=1S/C20H23ClF3N5O2/c1-12-19(28-18(26-12)11-25-6-3-7-31-2)15(8-13(23)10-22)20(29-30)27-14-4-5-17(24)16(21)9-14/h4-5,8-9,25,30H,1,3,6-7,10-11H2,2H3,(H,26,28)(H,27,29)/b13-8+,19-15- |
| InChIKey | CMPZMSGPORCANM-KGFIMHSTSA-N |
| XLogP | 2.42 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.88 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|