C15H22N6O2 — CID 122704185
N'-hydroxy-2-[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]-1H-benzimidazole-4-carboximidamide (PubChem CID 122704185) has the molecular formula C15H22N6O2 and a molecular weight of 318.38 g/mol. Its IUPAC name is N'-hydroxy-2-[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]-1H-benzimidazole-4-carboximidamide.
| Compound Name | N'-hydroxy-2-[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]-1H-benzimidazole-4-carboximidamide |
|---|---|
| PubChem CID | 122704185 |
| Molecular Formula | C15H22N6O2 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.18 |
| IUPAC Name | N'-hydroxy-2-[[1-(2-methoxyethyl)pyrrolidin-3-yl]amino]-1H-benzimidazole-4-carboximidamide |
| SMILES | COCCN1CCC(Nc2nc3c(C(N)=NO)cccc3[nH]2)C1 |
| InChI | InChI=1S/C15H22N6O2/c1-23-8-7-21-6-5-10(9-21)17-15-18-12-4-2-3-11(13(12)19-15)14(16)20-22/h2-4,10,22H,5-9H2,1H3,(H2,16,20)(H2,17,18,19) |
| InChIKey | PRUANWABPMCGEQ-UHFFFAOYSA-N |
| XLogP | 0.79 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 0.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|