C40H42F5NO7S3 — CID 140753318
[2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropyl]sulfonyl-[4-[1-adamantyl(naphthalen-2-yl)sulfonio]phenoxy]sulfonylazanide (PubChem CID 140753318) has the molecular formula C40H42F5NO7S3 and a molecular weight of 839.97 g/mol. Its IUPAC name is [2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropyl]sulfonyl-[4-[1-adamantyl(naphthalen-2-yl)sulfonio]phenoxy]sulfonylazanide.
| Compound Name | [2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropyl]sulfonyl-[4-[1-adamantyl(naphthalen-2-yl)sulfonio]phenoxy]sulfonylazanide |
|---|---|
| PubChem CID | 140753318 |
| Molecular Formula | C40H42F5NO7S3 |
| Molecular Weight | 839.97 g/mol |
| Exact Mass | 839.20 |
| IUPAC Name | [2-(adamantane-1-carbonyloxy)-1,1,3,3,3-pentafluoropropyl]sulfonyl-[4-[1-adamantyl(naphthalen-2-yl)sulfonio]phenoxy]sulfonylazanide |
| SMILES | O=C(OC(C(F)(F)F)C(F)(F)S(=O)(=O)[N-]S(=O)(=O)Oc1ccc([S+](c2ccc3ccccc3c2)C23CC4CC(CC(C4)C2)C3)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C40H42F5NO7S3/c41-39(42,43)35(52-36(47)37-18-24-11-25(19-37)13-26(12-24)20-37)40(44,45)55(48,49)46-56(50,51)53-32-6-9-33(10-7-32)54(34-8-5-30-3-1-2-4-31(30)17-34)38-21-27-14-28(22-38)16-29(15-27)23-38/h1-10,17,24-29,35H,11-16,18-23H2 |
| InChIKey | QHHLUBCEGUBIKW-UHFFFAOYSA-N |
| XLogP | 9.46 |
| TPSA | 117.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 839.97 |
| LogP ≤ 5 | 9.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|