C31H31F2NO7S3 — CID 140753276
[2-(adamantane-1-carbonyloxy)-1,1-difluoroethyl]sulfonyl-(4-diphenylsulfoniophenoxy)sulfonylazanide (PubChem CID 140753276) has the molecular formula C31H31F2NO7S3 and a molecular weight of 663.79 g/mol. Its IUPAC name is [2-(adamantane-1-carbonyloxy)-1,1-difluoroethyl]sulfonyl-(4-diphenylsulfoniophenoxy)sulfonylazanide.
| Compound Name | [2-(adamantane-1-carbonyloxy)-1,1-difluoroethyl]sulfonyl-(4-diphenylsulfoniophenoxy)sulfonylazanide |
|---|---|
| PubChem CID | 140753276 |
| Molecular Formula | C31H31F2NO7S3 |
| Molecular Weight | 663.79 g/mol |
| Exact Mass | 663.12 |
| IUPAC Name | [2-(adamantane-1-carbonyloxy)-1,1-difluoroethyl]sulfonyl-(4-diphenylsulfoniophenoxy)sulfonylazanide |
| SMILES | O=C(OCC(F)(F)S(=O)(=O)[N-]S(=O)(=O)Oc1ccc([S+](c2ccccc2)c2ccccc2)cc1)C12CC3CC(CC(C3)C1)C2 |
| InChI | InChI=1S/C31H31F2NO7S3/c32-31(33,21-40-29(35)30-18-22-15-23(19-30)17-24(16-22)20-30)43(36,37)34-44(38,39)41-25-11-13-28(14-12-25)42(26-7-3-1-4-8-26)27-9-5-2-6-10-27/h1-14,22-24H,15-21H2 |
| InChIKey | VJNAUXIWFHVAIA-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 117.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 663.79 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|