C20H39NO4Si — CID 140753713
tert-butyl N-[(1R,3S,4S)-3-formyl-4-tri(propan-2-yl)silyloxycyclopentyl]carbamate (PubChem CID 140753713) has the molecular formula C20H39NO4Si and a molecular weight of 385.62 g/mol. Its IUPAC name is tert-butyl N-[(1R,3S,4S)-3-formyl-4-tri(propan-2-yl)silyloxycyclopentyl]carbamate.
| Compound Name | tert-butyl N-[(1R,3S,4S)-3-formyl-4-tri(propan-2-yl)silyloxycyclopentyl]carbamate |
|---|---|
| PubChem CID | 140753713 |
| Molecular Formula | C20H39NO4Si |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 385.26 |
| IUPAC Name | tert-butyl N-[(1R,3S,4S)-3-formyl-4-tri(propan-2-yl)silyloxycyclopentyl]carbamate |
| SMILES | CC(C)[Si](O[C@H]1C[C@H](NC(=O)OC(C)(C)C)C[C@@H]1C=O)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H39NO4Si/c1-13(2)26(14(3)4,15(5)6)25-18-11-17(10-16(18)12-22)21-19(23)24-20(7,8)9/h12-18H,10-11H2,1-9H3,(H,21,23)/t16-,17-,18+/m1/s1 |
| InChIKey | PLAJEDFSFFWAJL-KURKYZTESA-N |
| XLogP | 5.05 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|