C9H18O4S2 — CID 140756052
3-pentylsulfonylthiolane 1,1-dioxide (PubChem CID 140756052) has the molecular formula C9H18O4S2 and a molecular weight of 254.37 g/mol. Its IUPAC name is 3-pentylsulfonylthiolane 1,1-dioxide.
| Compound Name | 3-pentylsulfonylthiolane 1,1-dioxide |
|---|---|
| PubChem CID | 140756052 |
| Molecular Formula | C9H18O4S2 |
| Molecular Weight | 254.37 g/mol |
| Exact Mass | 254.06 |
| IUPAC Name | 3-pentylsulfonylthiolane 1,1-dioxide |
| SMILES | CCCCCS(=O)(=O)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H18O4S2/c1-2-3-4-6-15(12,13)9-5-7-14(10,11)8-9/h9H,2-8H2,1H3 |
| InChIKey | MFIJOPKNSGOWEF-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.37 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|