C20H21N7O — CID 140756671
N-[5-[4-[(cyclopropylmethylamino)methyl]-2-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine (PubChem CID 140756671) has the molecular formula C20H21N7O and a molecular weight of 375.44 g/mol. Its IUPAC name is N-[5-[4-[(cyclopropylmethylamino)methyl]-2-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine.
| Compound Name | N-[5-[4-[(cyclopropylmethylamino)methyl]-2-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
|---|---|
| PubChem CID | 140756671 |
| Molecular Formula | C20H21N7O |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.18 |
| IUPAC Name | N-[5-[4-[(cyclopropylmethylamino)methyl]-2-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
| SMILES | [C-]#[N+]c1cnc(Nc2cc(-c3ccc(CNCC4CC4)cc3OC)[nH]n2)cn1 |
| InChI | InChI=1S/C20H21N7O/c1-21-19-11-24-20(12-23-19)25-18-8-16(26-27-18)15-6-5-14(7-17(15)28-2)10-22-9-13-3-4-13/h5-8,11-13,22H,3-4,9-10H2,2H3,(H2,24,25,26,27) |
| InChIKey | REQNGZDWFAJQOS-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 92.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|