C19H19FN8O — CID 140756722
N-[5-(2-fluoro-6-methoxy-4-piperazin-1-ylphenyl)-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine (PubChem CID 140756722) has the molecular formula C19H19FN8O and a molecular weight of 394.41 g/mol. Its IUPAC name is N-[5-(2-fluoro-6-methoxy-4-piperazin-1-ylphenyl)-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine.
| Compound Name | N-[5-(2-fluoro-6-methoxy-4-piperazin-1-ylphenyl)-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
|---|---|
| PubChem CID | 140756722 |
| Molecular Formula | C19H19FN8O |
| Molecular Weight | 394.41 g/mol |
| Exact Mass | 394.17 |
| IUPAC Name | N-[5-(2-fluoro-6-methoxy-4-piperazin-1-ylphenyl)-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
| SMILES | [C-]#[N+]c1cnc(Nc2cc(-c3c(F)cc(N4CCNCC4)cc3OC)[nH]n2)cn1 |
| InChI | InChI=1S/C19H19FN8O/c1-21-17-10-24-18(11-23-17)25-16-9-14(26-27-16)19-13(20)7-12(8-15(19)29-2)28-5-3-22-4-6-28/h7-11,22H,3-6H2,2H3,(H2,24,25,26,27) |
| InChIKey | XERGYEIIPHBGCV-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 95.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.41 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|