C22H25FN8O — CID 140756683
N-[5-[2-fluoro-6-methoxy-4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine (PubChem CID 140756683) has the molecular formula C22H25FN8O and a molecular weight of 436.50 g/mol. Its IUPAC name is N-[5-[2-fluoro-6-methoxy-4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine.
| Compound Name | N-[5-[2-fluoro-6-methoxy-4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
|---|---|
| PubChem CID | 140756683 |
| Molecular Formula | C22H25FN8O |
| Molecular Weight | 436.50 g/mol |
| Exact Mass | 436.21 |
| IUPAC Name | N-[5-[2-fluoro-6-methoxy-4-(4-propan-2-ylpiperazin-1-yl)phenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
| SMILES | [C-]#[N+]c1cnc(Nc2cc(-c3c(F)cc(N4CCN(C(C)C)CC4)cc3OC)[nH]n2)cn1 |
| InChI | InChI=1S/C22H25FN8O/c1-14(2)30-5-7-31(8-6-30)15-9-16(23)22(18(10-15)32-4)17-11-19(29-28-17)27-21-13-25-20(24-3)12-26-21/h9-14H,5-8H2,1-2,4H3,(H2,26,27,28,29) |
| InChIKey | PFARMMIQPGTWKI-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 86.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.50 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|