C20H20ClN7O — CID 140756678
N-[5-(5-chloro-2-methoxy-4-piperidin-4-ylphenyl)-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine (PubChem CID 140756678) has the molecular formula C20H20ClN7O and a molecular weight of 409.88 g/mol. Its IUPAC name is N-[5-(5-chloro-2-methoxy-4-piperidin-4-ylphenyl)-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine.
| Compound Name | N-[5-(5-chloro-2-methoxy-4-piperidin-4-ylphenyl)-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
|---|---|
| PubChem CID | 140756678 |
| Molecular Formula | C20H20ClN7O |
| Molecular Weight | 409.88 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | N-[5-(5-chloro-2-methoxy-4-piperidin-4-ylphenyl)-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
| SMILES | [C-]#[N+]c1cnc(Nc2cc(-c3cc(Cl)c(C4CCNCC4)cc3OC)[nH]n2)cn1 |
| InChI | InChI=1S/C20H20ClN7O/c1-22-19-10-25-20(11-24-19)26-18-9-16(27-28-18)14-7-15(21)13(8-17(14)29-2)12-3-5-23-6-4-12/h7-12,23H,3-6H2,2H3,(H2,25,26,27,28) |
| InChIKey | BXZGLAOOWXPOEB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 92.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.88 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|