C19H23N7O2 — CID 159678727
N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine;methane (PubChem CID 159678727) has the molecular formula C19H23N7O2 and a molecular weight of 381.44 g/mol. Its IUPAC name is N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine;methane.
| Compound Name | N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine;methane |
|---|---|
| PubChem CID | 159678727 |
| Molecular Formula | C19H23N7O2 |
| Molecular Weight | 381.44 g/mol |
| Exact Mass | 381.19 |
| IUPAC Name | N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine;methane |
| SMILES | C.[C-]#[N+]c1cnc(Nc2cc(-c3c(OC)cccc3OCCCN)[nH]n2)cn1 |
| InChI | InChI=1S/C18H19N7O2.CH4/c1-20-16-10-22-17(11-21-16)23-15-9-12(24-25-15)18-13(26-2)5-3-6-14(18)27-8-4-7-19;/h3,5-6,9-11H,4,7-8,19H2,2H3,(H2,22,23,24,25);1H4 |
| InChIKey | MUYCMXCRBDNCKM-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 115.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.44 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|