C19H20N6O2 — CID 89197637
N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-5-ethynylpyrazin-2-amine (PubChem CID 89197637) has the molecular formula C19H20N6O2 and a molecular weight of 364.41 g/mol. Its IUPAC name is N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-5-ethynylpyrazin-2-amine.
| Compound Name | N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-5-ethynylpyrazin-2-amine |
|---|---|
| PubChem CID | 89197637 |
| Molecular Formula | C19H20N6O2 |
| Molecular Weight | 364.41 g/mol |
| Exact Mass | 364.16 |
| IUPAC Name | N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-5-ethynylpyrazin-2-amine |
| SMILES | C#Cc1cnc(Nc2cc(-c3c(OC)cccc3OCCCN)[nH]n2)cn1 |
| InChI | InChI=1S/C19H20N6O2/c1-3-13-11-22-18(12-21-13)23-17-10-14(24-25-17)19-15(26-2)6-4-7-16(19)27-9-5-8-20/h1,4,6-7,10-12H,5,8-9,20H2,2H3,(H2,22,23,24,25) |
| InChIKey | ZORSSDIQNDNATA-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 110.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|