C17H18F3N7O2 — CID 163407442
N-[5-[2-(3-aminopropoxy)-4-methoxy-3-pyridinyl]-1H-pyrazol-3-yl]-5-(trifluoromethyl)pyrazin-2-amine (PubChem CID 163407442) has the molecular formula C17H18F3N7O2 and a molecular weight of 409.37 g/mol. Its IUPAC name is N-[5-[2-(3-aminopropoxy)-4-methoxy-3-pyridinyl]-1H-pyrazol-3-yl]-5-(trifluoromethyl)pyrazin-2-amine.
| Compound Name | N-[5-[2-(3-aminopropoxy)-4-methoxy-3-pyridinyl]-1H-pyrazol-3-yl]-5-(trifluoromethyl)pyrazin-2-amine |
|---|---|
| PubChem CID | 163407442 |
| Molecular Formula | C17H18F3N7O2 |
| Molecular Weight | 409.37 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | N-[5-[2-(3-aminopropoxy)-4-methoxy-3-pyridinyl]-1H-pyrazol-3-yl]-5-(trifluoromethyl)pyrazin-2-amine |
| SMILES | COc1ccnc(OCCCN)c1-c1cc(Nc2cnc(C(F)(F)F)cn2)n[nH]1 |
| InChI | InChI=1S/C17H18F3N7O2/c1-28-11-3-5-22-16(29-6-2-4-21)15(11)10-7-13(27-26-10)25-14-9-23-12(8-24-14)17(18,19)20/h3,5,7-9H,2,4,6,21H2,1H3,(H2,24,25,26,27) |
| InChIKey | NXKRYKBUTLHUGT-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 123.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.37 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|