C16H22FN7O2 — CID 146187995
N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-N'-(2,2-diaminoethenyl)carbamimidoyl fluoride (PubChem CID 146187995) has the molecular formula C16H22FN7O2 and a molecular weight of 363.40 g/mol. Its IUPAC name is N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-N'-(2,2-diaminoethenyl)carbamimidoyl fluoride.
| Compound Name | N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-N'-(2,2-diaminoethenyl)carbamimidoyl fluoride |
|---|---|
| PubChem CID | 146187995 |
| Molecular Formula | C16H22FN7O2 |
| Molecular Weight | 363.40 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | N-[5-[2-(3-aminopropoxy)-6-methoxyphenyl]-1H-pyrazol-3-yl]-N'-(2,2-diaminoethenyl)carbamimidoyl fluoride |
| SMILES | COc1cccc(OCCCN)c1-c1cc(N/C(F)=N/C=C(N)N)n[nH]1 |
| InChI | InChI=1S/C16H22FN7O2/c1-25-11-4-2-5-12(26-7-3-6-18)15(11)10-8-14(24-23-10)22-16(17)21-9-13(19)20/h2,4-5,8-9H,3,6-7,18-20H2,1H3,(H2,21,22,23,24) |
| InChIKey | CFGNHDTYEFIPKY-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 149.59 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|