C22H25N7O — CID 140756685
5-isocyano-N-[5-(4-piperidin-4-yl-2-propan-2-yloxyphenyl)-1H-pyrazol-3-yl]pyrazin-2-amine (PubChem CID 140756685) has the molecular formula C22H25N7O and a molecular weight of 403.49 g/mol. Its IUPAC name is 5-isocyano-N-[5-(4-piperidin-4-yl-2-propan-2-yloxyphenyl)-1H-pyrazol-3-yl]pyrazin-2-amine.
| Compound Name | 5-isocyano-N-[5-(4-piperidin-4-yl-2-propan-2-yloxyphenyl)-1H-pyrazol-3-yl]pyrazin-2-amine |
|---|---|
| PubChem CID | 140756685 |
| Molecular Formula | C22H25N7O |
| Molecular Weight | 403.49 g/mol |
| Exact Mass | 403.21 |
| IUPAC Name | 5-isocyano-N-[5-(4-piperidin-4-yl-2-propan-2-yloxyphenyl)-1H-pyrazol-3-yl]pyrazin-2-amine |
| SMILES | [C-]#[N+]c1cnc(Nc2cc(-c3ccc(C4CCNCC4)cc3OC(C)C)[nH]n2)cn1 |
| InChI | InChI=1S/C22H25N7O/c1-14(2)30-19-10-16(15-6-8-24-9-7-15)4-5-17(19)18-11-20(29-28-18)27-22-13-25-21(23-3)12-26-22/h4-5,10-15,24H,6-9H2,1-2H3,(H2,26,27,28,29) |
| InChIKey | OCXJJVDLTPSLQR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 92.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.49 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|