C21H24N8O — CID 140756708
N-[5-[4-(3,3-dimethylpiperazin-1-yl)-2-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine (PubChem CID 140756708) has the molecular formula C21H24N8O and a molecular weight of 404.48 g/mol. Its IUPAC name is N-[5-[4-(3,3-dimethylpiperazin-1-yl)-2-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine.
| Compound Name | N-[5-[4-(3,3-dimethylpiperazin-1-yl)-2-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
|---|---|
| PubChem CID | 140756708 |
| Molecular Formula | C21H24N8O |
| Molecular Weight | 404.48 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N-[5-[4-(3,3-dimethylpiperazin-1-yl)-2-methoxyphenyl]-1H-pyrazol-3-yl]-5-isocyanopyrazin-2-amine |
| SMILES | [C-]#[N+]c1cnc(Nc2cc(-c3ccc(N4CCNC(C)(C)C4)cc3OC)[nH]n2)cn1 |
| InChI | InChI=1S/C21H24N8O/c1-21(2)13-29(8-7-25-21)14-5-6-15(17(9-14)30-4)16-10-18(28-27-16)26-20-12-23-19(22-3)11-24-20/h5-6,9-12,25H,7-8,13H2,1-2,4H3,(H2,24,26,27,28) |
| InChIKey | QNOHEIBIBWEXHB-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 95.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.48 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|