C25H23BrF4N2O7 — CID 140760015
diethyl 2-[(6-bromo-2-ethoxycarbonyl-7-fluoroimidazo[1,2-a]pyridin-3-yl)-[2-(trifluoromethoxy)phenyl]methyl]propanedioate (PubChem CID 140760015) has the molecular formula C25H23BrF4N2O7 and a molecular weight of 619.36 g/mol. Its IUPAC name is diethyl 2-[(6-bromo-2-ethoxycarbonyl-7-fluoroimidazo[1,2-a]pyridin-3-yl)-[2-(trifluoromethoxy)phenyl]methyl]propanedioate.
| Compound Name | diethyl 2-[(6-bromo-2-ethoxycarbonyl-7-fluoroimidazo[1,2-a]pyridin-3-yl)-[2-(trifluoromethoxy)phenyl]methyl]propanedioate |
|---|---|
| PubChem CID | 140760015 |
| Molecular Formula | C25H23BrF4N2O7 |
| Molecular Weight | 619.36 g/mol |
| Exact Mass | 618.06 |
| IUPAC Name | diethyl 2-[(6-bromo-2-ethoxycarbonyl-7-fluoroimidazo[1,2-a]pyridin-3-yl)-[2-(trifluoromethoxy)phenyl]methyl]propanedioate |
| SMILES | CCOC(=O)c1nc2cc(F)c(Br)cn2c1C(c1ccccc1OC(F)(F)F)C(C(=O)OCC)C(=O)OCC |
| InChI | InChI=1S/C25H23BrF4N2O7/c1-4-36-22(33)19(23(34)37-5-2)18(13-9-7-8-10-16(13)39-25(28,29)30)21-20(24(35)38-6-3)31-17-11-15(27)14(26)12-32(17)21/h7-12,18-19H,4-6H2,1-3H3 |
| InChIKey | LPFWOYSTIFTASD-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 105.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.36 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|