C22H23FN2O5S — CID 140761387
N-[(1-benzoylazetidin-3-yl)methoxy-cyclopropyl-fluoromethyl]sulfonylbenzamide (PubChem CID 140761387) has the molecular formula C22H23FN2O5S and a molecular weight of 446.50 g/mol. Its IUPAC name is N-[(1-benzoylazetidin-3-yl)methoxy-cyclopropyl-fluoromethyl]sulfonylbenzamide.
| Compound Name | N-[(1-benzoylazetidin-3-yl)methoxy-cyclopropyl-fluoromethyl]sulfonylbenzamide |
|---|---|
| PubChem CID | 140761387 |
| Molecular Formula | C22H23FN2O5S |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.13 |
| IUPAC Name | N-[(1-benzoylazetidin-3-yl)methoxy-cyclopropyl-fluoromethyl]sulfonylbenzamide |
| SMILES | O=C(NS(=O)(=O)C(F)(OCC1CN(C(=O)c2ccccc2)C1)C1CC1)c1ccccc1 |
| InChI | InChI=1S/C22H23FN2O5S/c23-22(19-11-12-19,31(28,29)24-20(26)17-7-3-1-4-8-17)30-15-16-13-25(14-16)21(27)18-9-5-2-6-10-18/h1-10,16,19H,11-15H2,(H,24,26) |
| InChIKey | YYHUJVJANPLBSF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |