C15H25NO4Si — CID 140762923
N-[(2,2-dimethoxy-1,6,2-dioxasilocan-8-yl)methyl]-N-methylaniline (PubChem CID 140762923) has the molecular formula C15H25NO4Si and a molecular weight of 311.45 g/mol. Its IUPAC name is N-[(2,2-dimethoxy-1,6,2-dioxasilocan-8-yl)methyl]-N-methylaniline.
| Compound Name | N-[(2,2-dimethoxy-1,6,2-dioxasilocan-8-yl)methyl]-N-methylaniline |
|---|---|
| PubChem CID | 140762923 |
| Molecular Formula | C15H25NO4Si |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N-[(2,2-dimethoxy-1,6,2-dioxasilocan-8-yl)methyl]-N-methylaniline |
| SMILES | CO[Si]1(OC)CCCOCC(CN(C)c2ccccc2)O1 |
| InChI | InChI=1S/C15H25NO4Si/c1-16(14-8-5-4-6-9-14)12-15-13-19-10-7-11-21(17-2,18-3)20-15/h4-6,8-9,15H,7,10-13H2,1-3H3 |
| InChIKey | XRODLTNBUXBGEC-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|