C21H29NO2Si — CID 140762855
N-benzyl-N-[(2,2-dimethyl-1,6,2-dioxasilocan-8-yl)methyl]aniline (PubChem CID 140762855) has the molecular formula C21H29NO2Si and a molecular weight of 355.55 g/mol. Its IUPAC name is N-benzyl-N-[(2,2-dimethyl-1,6,2-dioxasilocan-8-yl)methyl]aniline.
| Compound Name | N-benzyl-N-[(2,2-dimethyl-1,6,2-dioxasilocan-8-yl)methyl]aniline |
|---|---|
| PubChem CID | 140762855 |
| Molecular Formula | C21H29NO2Si |
| Molecular Weight | 355.55 g/mol |
| Exact Mass | 355.20 |
| IUPAC Name | N-benzyl-N-[(2,2-dimethyl-1,6,2-dioxasilocan-8-yl)methyl]aniline |
| SMILES | C[Si]1(C)CCCOCC(CN(Cc2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C21H29NO2Si/c1-25(2)15-9-14-23-18-21(24-25)17-22(20-12-7-4-8-13-20)16-19-10-5-3-6-11-19/h3-8,10-13,21H,9,14-18H2,1-2H3 |
| InChIKey | MKEKAPZFPUMBRR-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.55 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|