C20H27NO2Si — CID 140762875
N-[(2,2-dimethyl-1,6,2-dioxasilocan-8-yl)methyl]-N-phenylaniline (PubChem CID 140762875) has the molecular formula C20H27NO2Si and a molecular weight of 341.53 g/mol. Its IUPAC name is N-[(2,2-dimethyl-1,6,2-dioxasilocan-8-yl)methyl]-N-phenylaniline.
| Compound Name | N-[(2,2-dimethyl-1,6,2-dioxasilocan-8-yl)methyl]-N-phenylaniline |
|---|---|
| PubChem CID | 140762875 |
| Molecular Formula | C20H27NO2Si |
| Molecular Weight | 341.53 g/mol |
| Exact Mass | 341.18 |
| IUPAC Name | N-[(2,2-dimethyl-1,6,2-dioxasilocan-8-yl)methyl]-N-phenylaniline |
| SMILES | C[Si]1(C)CCCOCC(CN(c2ccccc2)c2ccccc2)O1 |
| InChI | InChI=1S/C20H27NO2Si/c1-24(2)15-9-14-22-17-20(23-24)16-21(18-10-5-3-6-11-18)19-12-7-4-8-13-19/h3-8,10-13,20H,9,14-17H2,1-2H3 |
| InChIKey | BWZHCSBAQQBARH-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.53 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|