C16H15N2O4- — CID 140763076
(Z)-1-(1-benzylimidazol-4-yl)-4-ethoxy-3,4-dioxobut-1-en-1-olate (PubChem CID 140763076) has the molecular formula C16H15N2O4- and a molecular weight of 299.31 g/mol. Its IUPAC name is (Z)-1-(1-benzylimidazol-4-yl)-4-ethoxy-3,4-dioxobut-1-en-1-olate.
| Compound Name | (Z)-1-(1-benzylimidazol-4-yl)-4-ethoxy-3,4-dioxobut-1-en-1-olate |
|---|---|
| PubChem CID | 140763076 |
| Molecular Formula | C16H15N2O4- |
| Molecular Weight | 299.31 g/mol |
| Exact Mass | 299.10 |
| IUPAC Name | (Z)-1-(1-benzylimidazol-4-yl)-4-ethoxy-3,4-dioxobut-1-en-1-olate |
| SMILES | CCOC(=O)C(=O)/C=C(\[O-])c1cn(Cc2ccccc2)cn1 |
| InChI | InChI=1S/C16H16N2O4/c1-2-22-16(21)15(20)8-14(19)13-10-18(11-17-13)9-12-6-4-3-5-7-12/h3-8,10-11,19H,2,9H2,1H3/p-1/b14-8- |
| InChIKey | WDYLGGXGJOAFDP-ZSOIEALJSA-M |
| XLogP | 0.76 |
| TPSA | 84.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.31 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|