C32H16N4S — CID 140769262
2-[21-(4-isocyano-2-pyridinyl)-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaen-14-yl]pyridine-4-carbonitrile (PubChem CID 140769262) has the molecular formula C32H16N4S and a molecular weight of 488.58 g/mol. Its IUPAC name is 2-[21-(4-isocyano-2-pyridinyl)-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaen-14-yl]pyridine-4-carbonitrile.
| Compound Name | 2-[21-(4-isocyano-2-pyridinyl)-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaen-14-yl]pyridine-4-carbonitrile |
|---|---|
| PubChem CID | 140769262 |
| Molecular Formula | C32H16N4S |
| Molecular Weight | 488.58 g/mol |
| Exact Mass | 488.11 |
| IUPAC Name | 2-[21-(4-isocyano-2-pyridinyl)-10-thiapentacyclo[11.8.0.03,11.04,9.015,20]henicosa-1(21),2,4,6,8,11,13,15,17,19-decaen-14-yl]pyridine-4-carbonitrile |
| SMILES | [C-]#[N+]c1ccnc(-c2c3ccccc3c(-c3cc(C#N)ccn3)c3cc4sc5ccccc5c4cc23)c1 |
| InChI | InChI=1S/C32H16N4S/c1-34-20-11-13-36-28(15-20)31-22-7-2-3-8-23(22)32(27-14-19(18-33)10-12-35-27)26-17-30-24(16-25(26)31)21-6-4-5-9-29(21)37-30/h2-17H |
| InChIKey | NWDJSTICURNGGX-UHFFFAOYSA-N |
| XLogP | 8.91 |
| TPSA | 53.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.58 |
| LogP ≤ 5 | 8.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|