C16H20N3O4PS — CID 140771050
1-[(1R,2S,4S,6S,8R)-2-deuterio-6-(2-isocyanoethoxyphosphanyloxy)-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-2-sulfanylidenepyrimidin-4-one (PubChem CID 140771050) has the molecular formula C16H20N3O4PS and a molecular weight of 382.40 g/mol. Its IUPAC name is 1-[(1R,2S,4S,6S,8R)-2-deuterio-6-(2-isocyanoethoxyphosphanyloxy)-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-2-sulfanylidenepyrimidin-4-one.
| Compound Name | 1-[(1R,2S,4S,6S,8R)-2-deuterio-6-(2-isocyanoethoxyphosphanyloxy)-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-2-sulfanylidenepyrimidin-4-one |
|---|---|
| PubChem CID | 140771050 |
| Molecular Formula | C16H20N3O4PS |
| Molecular Weight | 382.40 g/mol |
| Exact Mass | 382.10 |
| IUPAC Name | 1-[(1R,2S,4S,6S,8R)-2-deuterio-6-(2-isocyanoethoxyphosphanyloxy)-9-oxatricyclo[4.3.0.02,4]nonan-8-yl]-5-methyl-2-sulfanylidenepyrimidin-4-one |
| SMILES | [2H][C@]12C[C@H]1C[C@]1(OPOCC[N+]#[C-])C[C@H](n3cc(C)c(=O)[nH]c3=S)O[C@@H]12 |
| InChI | InChI=1S/C16H20N3O4PS/c1-9-8-19(15(25)18-14(9)20)12-7-16(23-24-21-4-3-17-2)6-10-5-11(10)13(16)22-12/h8,10-13,24H,3-7H2,1H3,(H,18,20,25)/t10-,11-,12+,13+,16-/m0/s1/i11D |
| InChIKey | XTLUAPHMDHQYHL-FFVYAKGKSA-N |
| XLogP | 2.74 |
| TPSA | 69.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.40 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|