C18H30O — CID 140771732
1-pentyl-2-prop-2-ynoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene (PubChem CID 140771732) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 1-pentyl-2-prop-2-ynoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene.
| Compound Name | 1-pentyl-2-prop-2-ynoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
|---|---|
| PubChem CID | 140771732 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 1-pentyl-2-prop-2-ynoxy-1,2,3,4,4a,5,6,7,8,8a-decahydronaphthalene |
| SMILES | C#CCOC1CCC2CCCCC2C1CCCCC |
| InChI | InChI=1S/C18H30O/c1-3-5-6-11-17-16-10-8-7-9-15(16)12-13-18(17)19-14-4-2/h2,15-18H,3,5-14H2,1H3 |
| InChIKey | YGLVGFCKRQGLLB-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|