C12H14Cl4N2O2 — CID 140772815
2,2,2-trichloroethyl N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbamate;hydrochloride (PubChem CID 140772815) has the molecular formula C12H14Cl4N2O2 and a molecular weight of 360.07 g/mol. Its IUPAC name is 2,2,2-trichloroethyl N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbamate;hydrochloride.
| Compound Name | 2,2,2-trichloroethyl N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbamate;hydrochloride |
|---|---|
| PubChem CID | 140772815 |
| Molecular Formula | C12H14Cl4N2O2 |
| Molecular Weight | 360.07 g/mol |
| Exact Mass | 357.98 |
| IUPAC Name | 2,2,2-trichloroethyl N-(1,2,3,4-tetrahydroisoquinolin-6-yl)carbamate;hydrochloride |
| SMILES | Cl.O=C(Nc1ccc2c(c1)CCNC2)OCC(Cl)(Cl)Cl |
| InChI | InChI=1S/C12H13Cl3N2O2.ClH/c13-12(14,15)7-19-11(18)17-10-2-1-9-6-16-4-3-8(9)5-10;/h1-2,5,16H,3-4,6-7H2,(H,17,18);1H |
| InChIKey | CYFGPYOJPPMCPY-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.07 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|