C24H24F2N6O2S — CID 140773767
N-[1-[(3S)-1-(4-amino-2-cyano-4-methylpent-2-enoyl)pyrrolidin-3-yl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide (PubChem CID 140773767) has the molecular formula C24H24F2N6O2S and a molecular weight of 498.56 g/mol. Its IUPAC name is N-[1-[(3S)-1-(4-amino-2-cyano-4-methylpent-2-enoyl)pyrrolidin-3-yl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide.
| Compound Name | N-[1-[(3S)-1-(4-amino-2-cyano-4-methylpent-2-enoyl)pyrrolidin-3-yl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 140773767 |
| Molecular Formula | C24H24F2N6O2S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.16 |
| IUPAC Name | N-[1-[(3S)-1-(4-amino-2-cyano-4-methylpent-2-enoyl)pyrrolidin-3-yl]benzimidazol-2-yl]-5-(difluoromethyl)thiophene-2-carboxamide |
| SMILES | CC(C)(N)C=C(C#N)C(=O)N1CC[C@H](n2c(NC(=O)c3ccc(C(F)F)s3)nc3ccccc32)C1 |
| InChI | InChI=1S/C24H24F2N6O2S/c1-24(2,28)11-14(12-27)22(34)31-10-9-15(13-31)32-17-6-4-3-5-16(17)29-23(32)30-21(33)19-8-7-18(35-19)20(25)26/h3-8,11,15,20H,9-10,13,28H2,1-2H3,(H,29,30,33)/t15-/m0/s1 |
| InChIKey | CXHUGPXIBRZISP-HNNXBMFYSA-N |
| XLogP | 4.25 |
| TPSA | 117.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|