C9H17- — CID 140776035
1,2,4-trimethylcyclohexane (PubChem CID 140776035) has the molecular formula C9H17- and a molecular weight of 125.23 g/mol. Its IUPAC name is 1,2,4-trimethylcyclohexane.
| Compound Name | 1,2,4-trimethylcyclohexane |
|---|---|
| PubChem CID | 140776035 |
| Molecular Formula | C9H17- |
| Molecular Weight | 125.23 g/mol |
| Exact Mass | 125.13 |
| IUPAC Name | 1,2,4-trimethylcyclohexane |
| SMILES | CC1C[CH-]C(C)C(C)C1 |
| InChI | InChI=1S/C9H17/c1-7-4-5-8(2)9(3)6-7/h5,7-9H,4,6H2,1-3H3/q-1 |
| InChIKey | BLHVBUJWPPKNDS-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 125.23 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|