C9H17V- — CID 154692065
1,2,4-trimethylcyclohexane;vanadium (PubChem CID 154692065) has the molecular formula C9H17V- and a molecular weight of 176.18 g/mol. Its IUPAC name is 1,2,4-trimethylcyclohexane;vanadium.
| Compound Name | 1,2,4-trimethylcyclohexane;vanadium |
|---|---|
| PubChem CID | 154692065 |
| Molecular Formula | C9H17V- |
| Molecular Weight | 176.18 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1,2,4-trimethylcyclohexane;vanadium |
| SMILES | CC1[CH-]CC(C)C(C)C1.[V] |
| InChI | InChI=1S/C9H17.V/c1-7-4-5-8(2)9(3)6-7;/h4,7-9H,5-6H2,1-3H3;/q-1; |
| InChIKey | DKJCSPOHZUZCKJ-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.18 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|