C9H10N2O — CID 140776700
3-isocyano-2-methoxy-4,6-dimethylpyridine (PubChem CID 140776700) has the molecular formula C9H10N2O and a molecular weight of 162.19 g/mol. Its IUPAC name is 3-isocyano-2-methoxy-4,6-dimethylpyridine.
| Compound Name | 3-isocyano-2-methoxy-4,6-dimethylpyridine |
|---|---|
| PubChem CID | 140776700 |
| Molecular Formula | C9H10N2O |
| Molecular Weight | 162.19 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 3-isocyano-2-methoxy-4,6-dimethylpyridine |
| SMILES | [C-]#[N+]c1c(C)cc(C)nc1OC |
| InChI | InChI=1S/C9H10N2O/c1-6-5-7(2)11-9(12-4)8(6)10-3/h5H,1-2,4H3 |
| InChIKey | ZBUZWFZPZDAOQU-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 26.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.19 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|