C13H23NO — CID 171625416
ethane;2-methoxy-4,6-dimethyl-3-propan-2-ylpyridine (PubChem CID 171625416) has the molecular formula C13H23NO and a molecular weight of 209.33 g/mol. Its IUPAC name is ethane;2-methoxy-4,6-dimethyl-3-propan-2-ylpyridine.
| Compound Name | ethane;2-methoxy-4,6-dimethyl-3-propan-2-ylpyridine |
|---|---|
| PubChem CID | 171625416 |
| Molecular Formula | C13H23NO |
| Molecular Weight | 209.33 g/mol |
| Exact Mass | 209.18 |
| IUPAC Name | ethane;2-methoxy-4,6-dimethyl-3-propan-2-ylpyridine |
| SMILES | CC.COc1nc(C)cc(C)c1C(C)C |
| InChI | InChI=1S/C11H17NO.C2H6/c1-7(2)10-8(3)6-9(4)12-11(10)13-5;1-2/h6-7H,1-5H3;1-2H3 |
| InChIKey | BLSFIQRCNMARDS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.33 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |