C9H10N2O2 — CID 140752938
3-isocyano-2,4-dimethoxy-6-methylpyridine (PubChem CID 140752938) has the molecular formula C9H10N2O2 and a molecular weight of 178.19 g/mol. Its IUPAC name is 3-isocyano-2,4-dimethoxy-6-methylpyridine.
| Compound Name | 3-isocyano-2,4-dimethoxy-6-methylpyridine |
|---|---|
| PubChem CID | 140752938 |
| Molecular Formula | C9H10N2O2 |
| Molecular Weight | 178.19 g/mol |
| Exact Mass | 178.07 |
| IUPAC Name | 3-isocyano-2,4-dimethoxy-6-methylpyridine |
| SMILES | [C-]#[N+]c1c(OC)cc(C)nc1OC |
| InChI | InChI=1S/C9H10N2O2/c1-6-5-7(12-3)8(10-2)9(11-6)13-4/h5H,1,3-4H3 |
| InChIKey | RLVBCUAKZSASCG-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 35.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 178.19 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|