C9H8BrNO2 — CID 164663818
1-bromo-2-isocyano-3,5-dimethoxybenzene (PubChem CID 164663818) has the molecular formula C9H8BrNO2 and a molecular weight of 242.07 g/mol. Its IUPAC name is 1-bromo-2-isocyano-3,5-dimethoxybenzene.
| Compound Name | 1-bromo-2-isocyano-3,5-dimethoxybenzene |
|---|---|
| PubChem CID | 164663818 |
| Molecular Formula | C9H8BrNO2 |
| Molecular Weight | 242.07 g/mol |
| Exact Mass | 240.97 |
| IUPAC Name | 1-bromo-2-isocyano-3,5-dimethoxybenzene |
| SMILES | [C-]#[N+]c1c(Br)cc(OC)cc1OC |
| InChI | InChI=1S/C9H8BrNO2/c1-11-9-7(10)4-6(12-2)5-8(9)13-3/h4-5H,2-3H3 |
| InChIKey | ABNXWVZSKXAVRR-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 22.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.07 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|