C34H32N5O3+ — CID 140776814
1-[2-[(3S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]-5-naphthalen-2-yl-3H-indol-1-ium-3-carboxamide (PubChem CID 140776814) has the molecular formula C34H32N5O3+ and a molecular weight of 558.66 g/mol. Its IUPAC name is 1-[2-[(3S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]-5-naphthalen-2-yl-3H-indol-1-ium-3-carboxamide.
| Compound Name | 1-[2-[(3S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]-5-naphthalen-2-yl-3H-indol-1-ium-3-carboxamide |
|---|---|
| PubChem CID | 140776814 |
| Molecular Formula | C34H32N5O3+ |
| Molecular Weight | 558.66 g/mol |
| Exact Mass | 558.25 |
| IUPAC Name | 1-[2-[(3S)-3-[(6-methyl-2-pyridinyl)carbamoyl]-2-azabicyclo[2.2.1]heptan-2-yl]-2-oxoethyl]-5-naphthalen-2-yl-3H-indol-1-ium-3-carboxamide |
| SMILES | Cc1cccc(NC(=O)[C@@H]2C3CCC(C3)N2C(=O)C[N+]2=CC(C(N)=O)c3cc(-c4ccc5ccccc5c4)ccc32)n1 |
| InChI | InChI=1S/C34H31N5O3/c1-20-5-4-8-30(36-20)37-34(42)32-25-11-13-26(16-25)39(32)31(40)19-38-18-28(33(35)41)27-17-24(12-14-29(27)38)23-10-9-21-6-2-3-7-22(21)15-23/h2-10,12,14-15,17-18,25-26,28,32H,11,13,16,19H2,1H3,(H2-,35,36,37,41,42)/p+1/t25?,26?,28?,32-/m0/s1 |
| InChIKey | IWPWYEFSRDZTMC-JHFOWJKFSA-O |
| XLogP | 4.53 |
| TPSA | 108.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 558.66 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|