C19H17F3N6O3S — CID 140779943
N-[2-[(4aR,6R,8aR)-2-amino-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]oxazin-8a-yl]-1,3-thiazol-4-yl]-5-isocyano-3-methylpyridine-2-carboxamide (PubChem CID 140779943) has the molecular formula C19H17F3N6O3S and a molecular weight of 466.45 g/mol. Its IUPAC name is N-[2-[(4aR,6R,8aR)-2-amino-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]oxazin-8a-yl]-1,3-thiazol-4-yl]-5-isocyano-3-methylpyridine-2-carboxamide.
| Compound Name | N-[2-[(4aR,6R,8aR)-2-amino-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]oxazin-8a-yl]-1,3-thiazol-4-yl]-5-isocyano-3-methylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 140779943 |
| Molecular Formula | C19H17F3N6O3S |
| Molecular Weight | 466.45 g/mol |
| Exact Mass | 466.10 |
| IUPAC Name | N-[2-[(4aR,6R,8aR)-2-amino-6-(trifluoromethyl)-4a,5,6,8-tetrahydro-4H-pyrano[3,4-d][1,3]oxazin-8a-yl]-1,3-thiazol-4-yl]-5-isocyano-3-methylpyridine-2-carboxamide |
| SMILES | [C-]#[N+]c1cnc(C(=O)Nc2csc([C@]34CO[C@@H](C(F)(F)F)C[C@H]3COC(N)=N4)n2)c(C)c1 |
| InChI | InChI=1S/C19H17F3N6O3S/c1-9-3-11(24-2)5-25-14(9)15(29)26-13-7-32-16(27-13)18-8-31-12(19(20,21)22)4-10(18)6-30-17(23)28-18/h3,5,7,10,12H,4,6,8H2,1H3,(H2,23,28)(H,26,29)/t10-,12+,18-/m0/s1 |
| InChIKey | CZXUKXZTFAABIV-NMOXLHADSA-N |
| XLogP | 3.16 |
| TPSA | 116.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.45 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|